C31H30F3N5O8 — CID 87796475
1-(2-amino-2-hydroxy-3-oxobutanoyl)-2,3-dihydroindole-6-carboxamide;[2-(N-[3-(aminomethyl)benzoyl]anilino)acetyl] 2,2,2-trifluoroacetate (PubChem CID 87796475) has the molecular formula C31H30F3N5O8 and a molecular weight of 657.60 g/mol. Its IUPAC name is 1-(2-amino-2-hydroxy-3-oxobutanoyl)-2,3-dihydroindole-6-carboxamide;[2-(N-[3-(aminomethyl)benzoyl]anilino)acetyl] 2,2,2-trifluoroacetate.
| Compound Name | 1-(2-amino-2-hydroxy-3-oxobutanoyl)-2,3-dihydroindole-6-carboxamide;[2-(N-[3-(aminomethyl)benzoyl]anilino)acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87796475 |
| Molecular Formula | C31H30F3N5O8 |
| Molecular Weight | 657.60 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | 1-(2-amino-2-hydroxy-3-oxobutanoyl)-2,3-dihydroindole-6-carboxamide;[2-(N-[3-(aminomethyl)benzoyl]anilino)acetyl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)C(N)(O)C(=O)N1CCc2ccc(C(N)=O)cc21.NCc1cccc(C(=O)N(CC(=O)OC(=O)C(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C18H15F3N2O4.C13H15N3O4/c19-18(20,21)17(26)27-15(24)11-23(14-7-2-1-3-8-14)16(25)13-6-4-5-12(9-13)10-22;1-7(17)13(15,20)12(19)16-5-4-8-2-3-9(11(14)18)6-10(8)16/h1-9H,10-11,22H2;2-3,6,20H,4-5,15H2,1H3,(H2,14,18) |
| InChIKey | UYOPHXQBTRDXQV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 216.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|