C26H39FN2O5S — CID 87797925
(3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87797925) has the molecular formula C26H39FN2O5S and a molecular weight of 510.67 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87797925 |
| Molecular Formula | C26H39FN2O5S |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (3S,7S,10R,11S,12S)-3-[1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(F)[C@@H]2CC3OC3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N2)cs1 |
| InChI | InChI=1S/C26H39FN2O5S/c1-14-8-7-9-26(6)21(34-26)11-19(18(27)10-17-13-35-16(3)28-17)29-22(31)12-20(30)25(4,5)24(33)15(2)23(14)32/h10,13-15,19-21,23,30,32H,7-9,11-12H2,1-6H3,(H,29,31)/t14-,15+,19-,20-,21?,23-,26?/m0/s1 |
| InChIKey | IWNBBDXOKQJZBS-HFDVIDLKSA-N |
| XLogP | 3.96 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|