C13H19F3N4O5S — CID 87798167
tert-butyl 8-(methylsulfonyloxymethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 87798167) has the molecular formula C13H19F3N4O5S and a molecular weight of 400.38 g/mol. Its IUPAC name is tert-butyl 8-(methylsulfonyloxymethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 8-(methylsulfonyloxymethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 87798167 |
| Molecular Formula | C13H19F3N4O5S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | tert-butyl 8-(methylsulfonyloxymethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CNC(COS(C)(=O)=O)c2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C13H19F3N4O5S/c1-12(2,3)25-10(21)8-5-17-7(6-24-26(4,22)23)9-18-11(13(14,15)16)19-20(8)9/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | GHWSLIDGLMRNMA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|