About dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane
dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane (PubChem CID 87798343) has the molecular formula C20H35Cl2PRu
and a molecular weight of 478.45 g/mol. Its IUPAC name is dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane.
Molecular Properties
| Compound Name | dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane |
| PubChem CID | 87798343 |
| Molecular Formula | C20H35Cl2PRu |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane |
| SMILES | C1CCC(P(C2CCCC2)C2CCCC2)C1.CC(C)=CC=[Ru](Cl)Cl |
| InChI | InChI=1S/C15H27P.C5H8.2ClH.Ru/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-4-5(2)3;;;/h13-15H,1-12H2;1,4H,2-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | CNQKSFDRRVLFNK-UHFFFAOYSA-L |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane?
The IUPAC name of dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane (CID 87798343) is dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane.
What is the SMILES notation for dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane?
The canonical SMILES for dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane is C1CCC(P(C2CCCC2)C2CCCC2)C1.CC(C)=CC=[Ru](Cl)Cl.
What is the InChIKey of dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane?
The InChIKey is CNQKSFDRRVLFNK-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H27P.C5H8.2ClH.Ru/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-4-5(2)3;;;/h13-15H,1-12H2;1,4H,2-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane?
dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane has a molecular weight of 478.45 g/mol, XLogP of 7.98, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(3-methylbut-2-enylidene)ruthenium;tricyclopentylphosphane is sourced from PubChem (CID 87798343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).