C28H35FN6O — CID 87798515
4-(4-fluoro-2-methylphenyl)-8-oxido-8-[(1S)-1-phenylethyl]-N-(3-pyrrolidin-1-ylpropyl)-6,7-dihydro-5H-pyrimido[4,5-d]pyrimidin-8-ium-2-amine (PubChem CID 87798515) has the molecular formula C28H35FN6O and a molecular weight of 490.63 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylphenyl)-8-oxido-8-[(1S)-1-phenylethyl]-N-(3-pyrrolidin-1-ylpropyl)-6,7-dihydro-5H-pyrimido[4,5-d]pyrimidin-8-ium-2-amine.
| Compound Name | 4-(4-fluoro-2-methylphenyl)-8-oxido-8-[(1S)-1-phenylethyl]-N-(3-pyrrolidin-1-ylpropyl)-6,7-dihydro-5H-pyrimido[4,5-d]pyrimidin-8-ium-2-amine |
|---|---|
| PubChem CID | 87798515 |
| Molecular Formula | C28H35FN6O |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 4-(4-fluoro-2-methylphenyl)-8-oxido-8-[(1S)-1-phenylethyl]-N-(3-pyrrolidin-1-ylpropyl)-6,7-dihydro-5H-pyrimido[4,5-d]pyrimidin-8-ium-2-amine |
| SMILES | Cc1cc(F)ccc1-c1nc(NCCCN2CCCC2)nc2c1CNC[N+]2([O-])[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C28H35FN6O/c1-20-17-23(29)11-12-24(20)26-25-18-30-19-35(36,21(2)22-9-4-3-5-10-22)27(25)33-28(32-26)31-13-8-16-34-14-6-7-15-34/h3-5,9-12,17,21,30H,6-8,13-16,18-19H2,1-2H3,(H,31,32,33)/t21-,35?/m0/s1 |
| InChIKey | FWBAXLIREFGMEG-YEMWWFHJSA-N |
| XLogP | 5.12 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|