C11H16ClNO — CID 87798987
1-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chloropropan-2-one (PubChem CID 87798987) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chloropropan-2-one.
| Compound Name | 1-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chloropropan-2-one |
|---|---|
| PubChem CID | 87798987 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chloropropan-2-one |
| SMILES | O=C(CCl)CN1CC2CC=CCC2C1 |
| InChI | InChI=1S/C11H16ClNO/c12-5-11(14)8-13-6-9-3-1-2-4-10(9)7-13/h1-2,9-10H,3-8H2 |
| InChIKey | PBTBVLBCMYIEMT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|