C23H28ClN5O2 — CID 87799384
3-[3-[5-[6-chloro-2-(dimethylamino)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide (PubChem CID 87799384) has the molecular formula C23H28ClN5O2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 3-[3-[5-[6-chloro-2-(dimethylamino)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide.
| Compound Name | 3-[3-[5-[6-chloro-2-(dimethylamino)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 87799384 |
| Molecular Formula | C23H28ClN5O2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-[3-[5-[6-chloro-2-(dimethylamino)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
| SMILES | CN(C)c1nc(Cl)ccc1C(=O)N1CC2CN(c3cccc(CCC(N)=O)c3)CC2C1 |
| InChI | InChI=1S/C23H28ClN5O2/c1-27(2)22-19(7-8-20(24)26-22)23(31)29-13-16-11-28(12-17(16)14-29)18-5-3-4-15(10-18)6-9-21(25)30/h3-5,7-8,10,16-17H,6,9,11-14H2,1-2H3,(H2,25,30) |
| InChIKey | HXNHKAZCLZSENE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|