C14H15N3O5 — CID 87799455
2-(8-oxido-10-oxo-11-prop-2-enoxy-9,11-diaza-8-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl)acetic acid (PubChem CID 87799455) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-(8-oxido-10-oxo-11-prop-2-enoxy-9,11-diaza-8-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl)acetic acid.
| Compound Name | 2-(8-oxido-10-oxo-11-prop-2-enoxy-9,11-diaza-8-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl)acetic acid |
|---|---|
| PubChem CID | 87799455 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(8-oxido-10-oxo-11-prop-2-enoxy-9,11-diaza-8-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl)acetic acid |
| SMILES | C=CCON1C(=O)N2CC1c1ccccc1[N+]2([O-])CC(=O)O |
| InChI | InChI=1S/C14H15N3O5/c1-2-7-22-16-11-8-15(14(16)20)17(21,9-13(18)19)12-6-4-3-5-10(11)12/h2-6,11H,1,7-9H2,(H,18,19) |
| InChIKey | LFEFXSQCXAUSEG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|