C21H18FN3O6 — CID 87799565
6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indole-4-carboxylic acid (PubChem CID 87799565) has the molecular formula C21H18FN3O6 and a molecular weight of 427.39 g/mol. Its IUPAC name is 6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indole-4-carboxylic acid.
| Compound Name | 6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 87799565 |
| Molecular Formula | C21H18FN3O6 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indole-4-carboxylic acid |
| SMILES | COC(=O)N(C)Cc1ccc(-c2[nH]c3cc(F)cc(C(=O)O)c3c2/C=C/[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18FN3O6/c1-24(21(28)31-2)11-12-3-5-13(6-4-12)19-15(7-8-25(29)30)18-16(20(26)27)9-14(22)10-17(18)23-19/h3-10,23H,11H2,1-2H3,(H,26,27)/b8-7+ |
| InChIKey | OKKUVCYGLIILHJ-BQYQJAHWSA-N |
| XLogP | 4.12 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|