About (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide
(2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide (PubChem CID 87800282) has the molecular formula C15H16N2O5S
and a molecular weight of 336.37 g/mol. Its IUPAC name is (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide |
| PubChem CID | 87800282 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide |
| SMILES | N[C@@H](CO)C(=O)N(O)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2O5S/c16-14(10-18)15(19)17(20)23(21,22)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,18,20H,10,16H2/t14-/m0/s1 |
| InChIKey | KBEBVBGDISNRLZ-AWEZNQCLSA-N |
| XLogP | 0.58 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide?
The IUPAC name of (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide (CID 87800282) is (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide.
What is the SMILES notation for (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide?
The canonical SMILES for (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide is N[C@@H](CO)C(=O)N(O)S(=O)(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide?
The InChIKey is KBEBVBGDISNRLZ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H16N2O5S/c16-14(10-18)15(19)17(20)23(21,22)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,18,20H,10,16H2/t14-/m0/s1.
What are the key properties of (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide?
(2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide has a molecular weight of 336.37 g/mol, XLogP of 0.58, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N,3-dihydroxy-N-(4-phenylphenyl)sulfonylpropanamide is sourced from PubChem (CID 87800282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).