C15H15Cl2NO3 — CID 87800312
tert-butyl 2,2-dichloro-3-(3-ethynylanilino)-3-oxopropanoate (PubChem CID 87800312) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is tert-butyl 2,2-dichloro-3-(3-ethynylanilino)-3-oxopropanoate.
| Compound Name | tert-butyl 2,2-dichloro-3-(3-ethynylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 87800312 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | tert-butyl 2,2-dichloro-3-(3-ethynylanilino)-3-oxopropanoate |
| SMILES | C#Cc1cccc(NC(=O)C(Cl)(Cl)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H15Cl2NO3/c1-5-10-7-6-8-11(9-10)18-12(19)15(16,17)13(20)21-14(2,3)4/h1,6-9H,2-4H3,(H,18,19) |
| InChIKey | GVQHRLGNHJMOJK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|