About 2-methylprop-2-en-1-ol;oxirane
2-methylprop-2-en-1-ol;oxirane (PubChem CID 87800539) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-methylprop-2-en-1-ol;oxirane.
Molecular Properties
| Compound Name | 2-methylprop-2-en-1-ol;oxirane |
| PubChem CID | 87800539 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2-methylprop-2-en-1-ol;oxirane |
| SMILES | C1CO1.C=C(C)CO |
| InChI | InChI=1S/C4H8O.C2H4O/c1-4(2)3-5;1-2-3-1/h5H,1,3H2,2H3;1-2H2 |
| InChIKey | UVXAMDSDTUGVJY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-en-1-ol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-en-1-ol;oxirane?
The IUPAC name of 2-methylprop-2-en-1-ol;oxirane (CID 87800539) is 2-methylprop-2-en-1-ol;oxirane.
What is the SMILES notation for 2-methylprop-2-en-1-ol;oxirane?
The canonical SMILES for 2-methylprop-2-en-1-ol;oxirane is C1CO1.C=C(C)CO.
What is the InChIKey of 2-methylprop-2-en-1-ol;oxirane?
The InChIKey is UVXAMDSDTUGVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2H4O/c1-4(2)3-5;1-2-3-1/h5H,1,3H2,2H3;1-2H2.
What are the key properties of 2-methylprop-2-en-1-ol;oxirane?
2-methylprop-2-en-1-ol;oxirane has a molecular weight of 116.16 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-en-1-ol;oxirane is sourced from PubChem (CID 87800539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).