C16H35N3O2 — CID 87800600
[3-(butylamino)-2-(butylaminomethyl)-2-methylpropyl] N-ethylcarbamate (PubChem CID 87800600) has the molecular formula C16H35N3O2 and a molecular weight of 301.47 g/mol. Its IUPAC name is [3-(butylamino)-2-(butylaminomethyl)-2-methylpropyl] N-ethylcarbamate.
| Compound Name | [3-(butylamino)-2-(butylaminomethyl)-2-methylpropyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 87800600 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | [3-(butylamino)-2-(butylaminomethyl)-2-methylpropyl] N-ethylcarbamate |
| SMILES | CCCCNCC(C)(CNCCCC)COC(=O)NCC |
| InChI | InChI=1S/C16H35N3O2/c1-5-8-10-17-12-16(4,13-18-11-9-6-2)14-21-15(20)19-7-3/h17-18H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | SSUFCRXCQACQMW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|