C26H31N3O4S — CID 87801007
(2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[2-[(2-cyclohexyl-2-oxoethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 87801007) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[2-[(2-cyclohexyl-2-oxoethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[2-[(2-cyclohexyl-2-oxoethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87801007 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[2-[(2-cyclohexyl-2-oxoethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | O=C(CNCCOc1ccc(C[C@H](Nc2nc3ccccc3s2)C(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H31N3O4S/c30-23(19-6-2-1-3-7-19)17-27-14-15-33-20-12-10-18(11-13-20)16-22(25(31)32)29-26-28-21-8-4-5-9-24(21)34-26/h4-5,8-13,19,22,27H,1-3,6-7,14-17H2,(H,28,29)(H,31,32)/t22-/m0/s1 |
| InChIKey | WLVAJWLWSRNABK-QFIPXVFZSA-N |
| XLogP | 4.52 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|