About 2H-2,4-benzodiazepine-1-carboxamide
2H-2,4-benzodiazepine-1-carboxamide (PubChem CID 87801126) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 2H-2,4-benzodiazepine-1-carboxamide.
Molecular Properties
| Compound Name | 2H-2,4-benzodiazepine-1-carboxamide |
| PubChem CID | 87801126 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2H-2,4-benzodiazepine-1-carboxamide |
| SMILES | NC(=O)C1=c2ccccc2=CN=CN1 |
| InChI | InChI=1S/C10H9N3O/c11-10(14)9-8-4-2-1-3-7(8)5-12-6-13-9/h1-6H,(H2,11,14)(H,12,13) |
| InChIKey | SYVGJBDJVZNSCL-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-2,4-benzodiazepine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-2,4-benzodiazepine-1-carboxamide?
The IUPAC name of 2H-2,4-benzodiazepine-1-carboxamide (CID 87801126) is 2H-2,4-benzodiazepine-1-carboxamide.
What is the SMILES notation for 2H-2,4-benzodiazepine-1-carboxamide?
The canonical SMILES for 2H-2,4-benzodiazepine-1-carboxamide is NC(=O)C1=c2ccccc2=CN=CN1.
What is the InChIKey of 2H-2,4-benzodiazepine-1-carboxamide?
The InChIKey is SYVGJBDJVZNSCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-10(14)9-8-4-2-1-3-7(8)5-12-6-13-9/h1-6H,(H2,11,14)(H,12,13).
What are the key properties of 2H-2,4-benzodiazepine-1-carboxamide?
2H-2,4-benzodiazepine-1-carboxamide has a molecular weight of 187.20 g/mol, XLogP of -1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-2,4-benzodiazepine-1-carboxamide is sourced from PubChem (CID 87801126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).