C29H27F3N6O7 — CID 87801186
N-benzoyl-N-[9-[(2R,5R)-3-hydroxy-5-(hydroxymethyl)-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 87801186) has the molecular formula C29H27F3N6O7 and a molecular weight of 628.56 g/mol. Its IUPAC name is N-benzoyl-N-[9-[(2R,5R)-3-hydroxy-5-(hydroxymethyl)-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-benzoyl-N-[9-[(2R,5R)-3-hydroxy-5-(hydroxymethyl)-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 87801186 |
| Molecular Formula | C29H27F3N6O7 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | N-benzoyl-N-[9-[(2R,5R)-3-hydroxy-5-(hydroxymethyl)-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(c1ccccc1)N(C(=O)c1ccccc1)c1ncnc2c1ncn2[C@@H]1O[C@H](CO)C(OCCCNC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C29H27F3N6O7/c30-29(31,32)28(43)33-12-7-13-44-22-19(14-39)45-27(21(22)40)37-16-36-20-23(37)34-15-35-24(20)38(25(41)17-8-3-1-4-9-17)26(42)18-10-5-2-6-11-18/h1-6,8-11,15-16,19,21-22,27,39-40H,7,12-14H2,(H,33,43)/t19-,21?,22?,27-/m1/s1 |
| InChIKey | WYTFPPDLDRZEBH-AQWJDGEOSA-N |
| XLogP | 2.02 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|