C19H19ClN2O3 — CID 8780130
(3R)-N-(4-chloro-2-methylphenyl)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 8780130) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is (3R)-N-(4-chloro-2-methylphenyl)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(4-chloro-2-methylphenyl)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 8780130 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3R)-N-(4-chloro-2-methylphenyl)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1N1C[C@H](C(=O)Nc2ccc(Cl)cc2C)CC1=O |
| InChI | InChI=1S/C19H19ClN2O3/c1-12-9-14(20)7-8-15(12)21-19(24)13-10-18(23)22(11-13)16-5-3-4-6-17(16)25-2/h3-9,13H,10-11H2,1-2H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | NXUFJBUQWCEHLB-CYBMUJFWSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |