4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid

C10H9NO3 — CID 87801602

IUPAC4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid
SMILESO=C(O)C1NCc2ccccc2C1=O
InChIInChI=1S/C10H9NO3/c12-9-7-4-2-1-3-6(7)5-11-8(9)10(13)14/h1-4,8,11H,5H2,(H,13,14)
InChIKeyCJVQAYRYLURXQQ-UHFFFAOYSA-N
MW191.19 g/mol
LogP0.43
Rot. Bonds1

About 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid

4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 87801602) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid.

Molecular Properties

Compound Name4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid
PubChem CID87801602
Molecular FormulaC10H9NO3
Molecular Weight191.19 g/mol
Exact Mass191.06
IUPAC Name4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid
SMILESO=C(O)C1NCc2ccccc2C1=O
InChIInChI=1S/C10H9NO3/c12-9-7-4-2-1-3-6(7)5-11-8(9)10(13)14/h1-4,8,11H,5H2,(H,13,14)
InChIKeyCJVQAYRYLURXQQ-UHFFFAOYSA-N
XLogP0.43
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 50.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The IUPAC name of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid (CID 87801602) is 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid is O=C(O)C1NCc2ccccc2C1=O.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The InChIKey is CJVQAYRYLURXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c12-9-7-4-2-1-3-6(7)5-11-8(9)10(13)14/h1-4,8,11H,5H2,(H,13,14).
What are the key properties of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid has a molecular weight of 191.19 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid is sourced from PubChem (CID 87801602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).