About 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid
4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 87801602) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid |
| PubChem CID | 87801602 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1NCc2ccccc2C1=O |
| InChI | InChI=1S/C10H9NO3/c12-9-7-4-2-1-3-6(7)5-11-8(9)10(13)14/h1-4,8,11H,5H2,(H,13,14) |
| InChIKey | CJVQAYRYLURXQQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The IUPAC name of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid (CID 87801602) is 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid is O=C(O)C1NCc2ccccc2C1=O.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
The InChIKey is CJVQAYRYLURXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c12-9-7-4-2-1-3-6(7)5-11-8(9)10(13)14/h1-4,8,11H,5H2,(H,13,14).
What are the key properties of 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid?
4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid has a molecular weight of 191.19 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-isoquinoline-3-carboxylic acid is sourced from PubChem (CID 87801602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).