C10H16Cl2O3 — CID 878019
(2R,5S)-2-tert-butyl-5-(dichloromethyl)-5-hydroxy-2-methyloxolan-3-one (PubChem CID 878019) has the molecular formula C10H16Cl2O3 and a molecular weight of 255.14 g/mol. Its IUPAC name is (2R,5S)-2-tert-butyl-5-(dichloromethyl)-5-hydroxy-2-methyloxolan-3-one.
| Compound Name | (2R,5S)-2-tert-butyl-5-(dichloromethyl)-5-hydroxy-2-methyloxolan-3-one |
|---|---|
| PubChem CID | 878019 |
| Molecular Formula | C10H16Cl2O3 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (2R,5S)-2-tert-butyl-5-(dichloromethyl)-5-hydroxy-2-methyloxolan-3-one |
| SMILES | CC(C)(C)[C@@]1(C)O[C@](O)(C(Cl)Cl)CC1=O |
| InChI | InChI=1S/C10H16Cl2O3/c1-8(2,3)9(4)6(13)5-10(14,15-9)7(11)12/h7,14H,5H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | ADFBOHINSCUDJG-UWVGGRQHSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|