About 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde
1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde (PubChem CID 87802133) has the molecular formula C14H15N2O2+
and a molecular weight of 243.29 g/mol. Its IUPAC name is 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde |
| PubChem CID | 87802133 |
| Molecular Formula | C14H15N2O2+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde |
| SMILES | CC[n+]1ccc(C=O)cc1.O=Cc1ccccn1 |
| InChI | InChI=1S/C8H10NO.C6H5NO/c1-2-9-5-3-8(7-10)4-6-9;8-5-6-3-1-2-4-7-6/h3-7H,2H2,1H3;1-5H/q+1; |
| InChIKey | FFHYJQSSSVBRSV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde?
The IUPAC name of 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde (CID 87802133) is 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde.
What is the SMILES notation for 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde?
The canonical SMILES for 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde is CC[n+]1ccc(C=O)cc1.O=Cc1ccccn1.
What is the InChIKey of 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde?
The InChIKey is FFHYJQSSSVBRSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO.C6H5NO/c1-2-9-5-3-8(7-10)4-6-9;8-5-6-3-1-2-4-7-6/h3-7H,2H2,1H3;1-5H/q+1;.
What are the key properties of 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde?
1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde has a molecular weight of 243.29 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridin-1-ium-4-carbaldehyde;pyridine-2-carbaldehyde is sourced from PubChem (CID 87802133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).