C28H19F8NO3S2 — CID 87802308
2-[2-[[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]sulfanylmethyl]phenoxy]acetic acid (PubChem CID 87802308) has the molecular formula C28H19F8NO3S2 and a molecular weight of 633.58 g/mol. Its IUPAC name is 2-[2-[[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]sulfanylmethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]sulfanylmethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 87802308 |
| Molecular Formula | C28H19F8NO3S2 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 633.07 |
| IUPAC Name | 2-[2-[[1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]sulfanylmethyl]phenoxy]acetic acid |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(Cc1c(F)c(F)c(F)c(F)c1F)SCc1ccccc1OCC(=O)O |
| InChI | InChI=1S/C28H19F8NO3S2/c1-13-26(42-27(37-13)14-6-8-16(9-7-14)28(34,35)36)19(10-17-21(29)23(31)25(33)24(32)22(17)30)41-12-15-4-2-3-5-18(15)40-11-20(38)39/h2-9,19H,10-12H2,1H3,(H,38,39) |
| InChIKey | CODNHBPCTWOSDA-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|