C7H10N2O2S — CID 87802390
1,3,5-trimethyl-6-sulfanylidene-1,3-diazinane-2,4-dione (PubChem CID 87802390) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 1,3,5-trimethyl-6-sulfanylidene-1,3-diazinane-2,4-dione.
| Compound Name | 1,3,5-trimethyl-6-sulfanylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 87802390 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 1,3,5-trimethyl-6-sulfanylidene-1,3-diazinane-2,4-dione |
| SMILES | CC1C(=O)N(C)C(=O)N(C)C1=S |
| InChI | InChI=1S/C7H10N2O2S/c1-4-5(10)8(2)7(11)9(3)6(4)12/h4H,1-3H3 |
| InChIKey | NPHGLDPXHZGRHT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|