C10H13F5N4O2 — CID 87803258
1-hexyl-4-nitro-5-(1,1,2,2,2-pentafluoroethyl)triazole (PubChem CID 87803258) has the molecular formula C10H13F5N4O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-hexyl-4-nitro-5-(1,1,2,2,2-pentafluoroethyl)triazole.
| Compound Name | 1-hexyl-4-nitro-5-(1,1,2,2,2-pentafluoroethyl)triazole |
|---|---|
| PubChem CID | 87803258 |
| Molecular Formula | C10H13F5N4O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-hexyl-4-nitro-5-(1,1,2,2,2-pentafluoroethyl)triazole |
| SMILES | CCCCCCn1nnc([N+](=O)[O-])c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5N4O2/c1-2-3-4-5-6-18-7(8(16-17-18)19(20)21)9(11,12)10(13,14)15/h2-6H2,1H3 |
| InChIKey | RADIRWVZPRYJRS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|