C7H5Cl5F5N3 — CID 87803336
2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole (PubChem CID 87803336) has the molecular formula C7H5Cl5F5N3 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole.
| Compound Name | 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87803336 |
| Molecular Formula | C7H5Cl5F5N3 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
| SMILES | CN1N=CN(C(F)(F)C(F)(F)F)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H5Cl5F5N3/c1-19-3(4(8,9)5(10,11)12)20(2-18-19)7(16,17)6(13,14)15/h2-3H,1H3 |
| InChIKey | GGHHKNMGIDXITI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|