C8H5F5N6O — CID 87803426
[3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 87803426) has the molecular formula C8H5F5N6O and a molecular weight of 296.16 g/mol. Its IUPAC name is [3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 87803426 |
| Molecular Formula | C8H5F5N6O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | [3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | Cc1nc(C(F)(F)C(F)(F)F)n(C(=O)n2cncn2)n1 |
| InChI | InChI=1S/C8H5F5N6O/c1-4-16-5(7(9,10)8(11,12)13)19(17-4)6(20)18-3-14-2-15-18/h2-3H,1H3 |
| InChIKey | JLEWJSSXBIKIIG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|