C14H16N2 — CID 87803466
2,3,5,6,7,11-hexahydro-1H-indolizino[8,7-b]indole (PubChem CID 87803466) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2,3,5,6,7,11-hexahydro-1H-indolizino[8,7-b]indole.
| Compound Name | 2,3,5,6,7,11-hexahydro-1H-indolizino[8,7-b]indole |
|---|---|
| PubChem CID | 87803466 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,3,5,6,7,11-hexahydro-1H-indolizino[8,7-b]indole |
| SMILES | C1=CCc2c3c([nH]c2=C1)=C1CCCN1CC3 |
| InChI | InChI=1S/C14H16N2/c1-2-5-12-10(4-1)11-7-9-16-8-3-6-13(16)14(11)15-12/h1-2,5,15H,3-4,6-9H2 |
| InChIKey | LINUWAVZLXQJKN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |