About 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene
2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene (PubChem CID 87803505) has the molecular formula C11H12F3NO5S
and a molecular weight of 327.28 g/mol. Its IUPAC name is 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene.
Molecular Properties
| Compound Name | 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene |
| PubChem CID | 87803505 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.NC(=O)C(O)C(O)C=S(=O)=O |
| InChI | InChI=1S/C7H5F3.C4H7NO5S/c8-7(9,10)6-4-2-1-3-5-6;5-4(8)3(7)2(6)1-11(9)10/h1-5H;1-3,6-7H,(H2,5,8) |
| InChIKey | VSPHTTIZBJRPIP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene?
The IUPAC name of 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene (CID 87803505) is 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene.
What is the SMILES notation for 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene?
The canonical SMILES for 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene is FC(F)(F)c1ccccc1.NC(=O)C(O)C(O)C=S(=O)=O.
What is the InChIKey of 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene?
The InChIKey is VSPHTTIZBJRPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.C4H7NO5S/c8-7(9,10)6-4-2-1-3-5-6;5-4(8)3(7)2(6)1-11(9)10/h1-5H;1-3,6-7H,(H2,5,8).
What are the key properties of 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene?
2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene has a molecular weight of 327.28 g/mol, XLogP of -0.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-4-sulfonylbutanamide;trifluoromethylbenzene is sourced from PubChem (CID 87803505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).