C5H3F5N4 — CID 87804041
5-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole-4-carbonitrile (PubChem CID 87804041) has the molecular formula C5H3F5N4 and a molecular weight of 214.10 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole-4-carbonitrile.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 87804041 |
| Molecular Formula | C5H3F5N4 |
| Molecular Weight | 214.10 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole-4-carbonitrile |
| SMILES | N#CN1C=NNC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F5N4/c6-4(7,5(8,9)10)3-13-12-2-14(3)1-11/h2-3,13H |
| InChIKey | RKXQSROCJFFNPR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|