C7H8F5N3 — CID 87804077
1-ethyl-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole (PubChem CID 87804077) has the molecular formula C7H8F5N3 and a molecular weight of 229.15 g/mol. Its IUPAC name is 1-ethyl-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole.
| Compound Name | 1-ethyl-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
|---|---|
| PubChem CID | 87804077 |
| Molecular Formula | C7H8F5N3 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-ethyl-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
| SMILES | CCn1nnc(C)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5N3/c1-3-15-5(4(2)13-14-15)6(8,9)7(10,11)12/h3H2,1-2H3 |
| InChIKey | UZZLEFBZEUMLPF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|