C4H3ClF5N3 — CID 87804346
5-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole (PubChem CID 87804346) has the molecular formula C4H3ClF5N3 and a molecular weight of 223.53 g/mol. Its IUPAC name is 5-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole.
| Compound Name | 5-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 87804346 |
| Molecular Formula | C4H3ClF5N3 |
| Molecular Weight | 223.53 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 5-chloro-4-(1,1,2,2,2-pentafluoroethyl)-1,5-dihydro-1,2,4-triazole |
| SMILES | FC(F)(F)C(F)(F)N1C=NNC1Cl |
| InChI | InChI=1S/C4H3ClF5N3/c5-2-12-11-1-13(2)4(9,10)3(6,7)8/h1-2,12H |
| InChIKey | ZLPFIBAIDLXNAS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|