About 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile
2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile (PubChem CID 87804638) has the molecular formula C5H7FN4
and a molecular weight of 142.14 g/mol. Its IUPAC name is 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile |
| PubChem CID | 87804638 |
| Molecular Formula | C5H7FN4 |
| Molecular Weight | 142.14 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile |
| SMILES | CCN1N=CN(C#N)C1F |
| InChI | InChI=1S/C5H7FN4/c1-2-10-5(6)9(3-7)4-8-10/h4-5H,2H2,1H3 |
| InChIKey | DQWXFDFEPDRTFX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile?
The IUPAC name of 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile (CID 87804638) is 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile.
What is the SMILES notation for 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile?
The canonical SMILES for 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile is CCN1N=CN(C#N)C1F.
What is the InChIKey of 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile?
The InChIKey is DQWXFDFEPDRTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN4/c1-2-10-5(6)9(3-7)4-8-10/h4-5H,2H2,1H3.
What are the key properties of 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile?
2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile has a molecular weight of 142.14 g/mol, XLogP of 0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-fluoro-3H-1,2,4-triazole-4-carbonitrile is sourced from PubChem (CID 87804638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).