C20H11F5O3 — CID 87804804
(2,3,4,5,6-pentafluorophenyl) 2-(4-phenylphenoxy)acetate (PubChem CID 87804804) has the molecular formula C20H11F5O3 and a molecular weight of 394.30 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(4-phenylphenoxy)acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 87804804 |
| Molecular Formula | C20H11F5O3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-phenylphenoxy)acetate |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H11F5O3/c21-15-16(22)18(24)20(19(25)17(15)23)28-14(26)10-27-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | BVSGQQHSHRNXDK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|