C7H9Cl6N3 — CID 87804928
2-propan-2-yl-3,4-bis(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 87804928) has the molecular formula C7H9Cl6N3 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-propan-2-yl-3,4-bis(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 2-propan-2-yl-3,4-bis(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804928 |
| Molecular Formula | C7H9Cl6N3 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 344.89 |
| IUPAC Name | 2-propan-2-yl-3,4-bis(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CC(C)N1N=CN(C(Cl)(Cl)Cl)C1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9Cl6N3/c1-4(2)16-5(6(8,9)10)15(3-14-16)7(11,12)13/h3-5H,1-2H3 |
| InChIKey | AFYVPBXUFUKVLW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|