C6H5Cl8N3 — CID 87804933
2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 87804933) has the molecular formula C6H5Cl8N3 and a molecular weight of 402.75 g/mol. Its IUPAC name is 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804933 |
| Molecular Formula | C6H5Cl8N3 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 398.80 |
| IUPAC Name | 2-methyl-3-(1,1,2,2,2-pentachloroethyl)-4-(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CN1N=CN(C(Cl)(Cl)Cl)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H5Cl8N3/c1-16-3(4(7,8)5(9,10)11)17(2-15-16)6(12,13)14/h2-3H,1H3 |
| InChIKey | LAYIOZBHGOWRMP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|