C11H18F5N3 — CID 87805389
4-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3H-1,2,4-triazole (PubChem CID 87805389) has the molecular formula C11H18F5N3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3H-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87805389 |
| Molecular Formula | C11H18F5N3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)-2-propyl-3H-1,2,4-triazole |
| SMILES | CCCN1N=CN(C(C)(C)C)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H18F5N3/c1-5-6-19-8(10(12,13)11(14,15)16)18(7-17-19)9(2,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | NROKYBHDZYNYNL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|