C8H12F5N3 — CID 87805897
2,4-diethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole (PubChem CID 87805897) has the molecular formula C8H12F5N3 and a molecular weight of 245.19 g/mol. Its IUPAC name is 2,4-diethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole.
| Compound Name | 2,4-diethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87805897 |
| Molecular Formula | C8H12F5N3 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,4-diethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
| SMILES | CCN1C=NN(CC)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F5N3/c1-3-15-5-14-16(4-2)6(15)7(9,10)8(11,12)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | QPCZWJFQIWBXHA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|