About butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane
butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 87806186) has the molecular formula C14H29IOSi
and a molecular weight of 368.38 g/mol. Its IUPAC name is butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
| PubChem CID | 87806186 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC[C@@H](/C=C/I)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C14H29IOSi/c1-5-7-9-10-14(11-12-15)16-17(3,4)13-8-6-2/h11-12,14H,5-10,13H2,1-4H3/b12-11+/t14-/m0/s1 |
| InChIKey | HZHNNFQVJQNPCK-GETOMWPZSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The IUPAC name of butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane (CID 87806186) is butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane.
What is the SMILES notation for butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The canonical SMILES for butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane is CCCCC[C@@H](/C=C/I)O[Si](C)(C)CCCC.
What is the InChIKey of butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The InChIKey is HZHNNFQVJQNPCK-GETOMWPZSA-N. The full InChI is InChI=1S/C14H29IOSi/c1-5-7-9-10-14(11-12-15)16-17(3,4)13-8-6-2/h11-12,14H,5-10,13H2,1-4H3/b12-11+/t14-/m0/s1.
What are the key properties of butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane has a molecular weight of 368.38 g/mol, XLogP of 5.91, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[(E,3S)-1-iodooct-1-en-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 87806186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).