C8H9Cl8N3 — CID 87806667
3-(1,1,2,2,2-pentachloroethyl)-2-propyl-4-(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 87806667) has the molecular formula C8H9Cl8N3 and a molecular weight of 430.81 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentachloroethyl)-2-propyl-4-(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 3-(1,1,2,2,2-pentachloroethyl)-2-propyl-4-(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87806667 |
| Molecular Formula | C8H9Cl8N3 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 426.83 |
| IUPAC Name | 3-(1,1,2,2,2-pentachloroethyl)-2-propyl-4-(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CCCN1N=CN(C(Cl)(Cl)Cl)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H9Cl8N3/c1-2-3-19-5(6(9,10)7(11,12)13)18(4-17-19)8(14,15)16/h4-5H,2-3H2,1H3 |
| InChIKey | QBBRBKVDIVUZNH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|