C21H41N2+ — CID 87806899
1-butyl-2,3-diheptylimidazol-3-ium (PubChem CID 87806899) has the molecular formula C21H41N2+ and a molecular weight of 321.57 g/mol. Its IUPAC name is 1-butyl-2,3-diheptylimidazol-3-ium.
| Compound Name | 1-butyl-2,3-diheptylimidazol-3-ium |
|---|---|
| PubChem CID | 87806899 |
| Molecular Formula | C21H41N2+ |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.33 |
| IUPAC Name | 1-butyl-2,3-diheptylimidazol-3-ium |
| SMILES | CCCCCCCc1n(CCCC)cc[n+]1CCCCCCC |
| InChI | InChI=1S/C21H41N2/c1-4-7-10-12-14-16-21-22(17-9-6-3)19-20-23(21)18-15-13-11-8-5-2/h19-20H,4-18H2,1-3H3/q+1 |
| InChIKey | NASDAWXGBQHTQY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|