C14H10F5NO3 — CID 87807235
(2,3,4,5,6-pentafluorophenyl) 3-butan-2-yl-1,2-oxazole-5-carboxylate (PubChem CID 87807235) has the molecular formula C14H10F5NO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-butan-2-yl-1,2-oxazole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-butan-2-yl-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 87807235 |
| Molecular Formula | C14H10F5NO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-butan-2-yl-1,2-oxazole-5-carboxylate |
| SMILES | CCC(C)c1cc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)on1 |
| InChI | InChI=1S/C14H10F5NO3/c1-3-5(2)6-4-7(23-20-6)14(21)22-13-11(18)9(16)8(15)10(17)12(13)19/h4-5H,3H2,1-2H3 |
| InChIKey | FGNOMXWAIBKLAV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|