C19H29N2+ — CID 87808171
1-ethyl-2-pentyl-3-(3-phenylpropyl)imidazol-3-ium (PubChem CID 87808171) has the molecular formula C19H29N2+ and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-ethyl-2-pentyl-3-(3-phenylpropyl)imidazol-3-ium.
| Compound Name | 1-ethyl-2-pentyl-3-(3-phenylpropyl)imidazol-3-ium |
|---|---|
| PubChem CID | 87808171 |
| Molecular Formula | C19H29N2+ |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 1-ethyl-2-pentyl-3-(3-phenylpropyl)imidazol-3-ium |
| SMILES | CCCCCc1n(CC)cc[n+]1CCCc1ccccc1 |
| InChI | InChI=1S/C19H29N2/c1-3-5-7-14-19-20(4-2)16-17-21(19)15-10-13-18-11-8-6-9-12-18/h6,8-9,11-12,16-17H,3-5,7,10,13-15H2,1-2H3/q+1 |
| InChIKey | HXTRSZXAWBJORM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|