C12H23N2+ — CID 87808411
1,3-diethyl-2-pentylimidazol-1-ium (PubChem CID 87808411) has the molecular formula C12H23N2+ and a molecular weight of 195.33 g/mol. Its IUPAC name is 1,3-diethyl-2-pentylimidazol-1-ium.
| Compound Name | 1,3-diethyl-2-pentylimidazol-1-ium |
|---|---|
| PubChem CID | 87808411 |
| Molecular Formula | C12H23N2+ |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | 1,3-diethyl-2-pentylimidazol-1-ium |
| SMILES | CCCCCc1n(CC)cc[n+]1CC |
| InChI | InChI=1S/C12H23N2/c1-4-7-8-9-12-13(5-2)10-11-14(12)6-3/h10-11H,4-9H2,1-3H3/q+1 |
| InChIKey | ZILRBUBPDMCFCR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|