About 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene
1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene (PubChem CID 87812613) has the molecular formula C22H11F6O3P
and a molecular weight of 468.29 g/mol. Its IUPAC name is 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene.
Molecular Properties
| Compound Name | 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
| PubChem CID | 87812613 |
| Molecular Formula | C22H11F6O3P |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
| SMILES | O=Pc1cccc(-c2ccc(OC(F)=C(F)F)cc2)c1-c1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C22H11F6O3P/c23-19(24)21(27)30-14-8-4-12(5-9-14)16-2-1-3-17(32-29)18(16)13-6-10-15(11-7-13)31-22(28)20(25)26/h1-11H |
| InChIKey | RLGKDKHAMNBABH-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene?
The IUPAC name of 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene (CID 87812613) is 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene.
What is the SMILES notation for 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene?
The canonical SMILES for 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene is O=Pc1cccc(-c2ccc(OC(F)=C(F)F)cc2)c1-c1ccc(OC(F)=C(F)F)cc1.
What is the InChIKey of 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene?
The InChIKey is RLGKDKHAMNBABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F6O3P/c23-19(24)21(27)30-14-8-4-12(5-9-14)16-2-1-3-17(32-29)18(16)13-6-10-15(11-7-13)31-22(28)20(25)26/h1-11H.
What are the key properties of 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene?
1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene has a molecular weight of 468.29 g/mol, XLogP of 7.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phosphoroso-2,3-bis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene is sourced from PubChem (CID 87812613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).