C24H27Cl2N3O4S — CID 87812859
N-(2-cyclopentylethyl)-2-[5-[1-(2,4-dichlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 87812859) has the molecular formula C24H27Cl2N3O4S and a molecular weight of 524.47 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-2-[5-[1-(2,4-dichlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-cyclopentylethyl)-2-[5-[1-(2,4-dichlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 87812859 |
| Molecular Formula | C24H27Cl2N3O4S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | N-(2-cyclopentylethyl)-2-[5-[1-(2,4-dichlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)SC(=C2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)C1=O)NCCC1CCCC1 |
| InChI | InChI=1S/C24H27Cl2N3O4S/c25-17-5-6-18(19(26)13-17)22(31)28-11-8-16(9-12-28)21-23(32)29(24(33)34-21)14-20(30)27-10-7-15-3-1-2-4-15/h5-6,13,15H,1-4,7-12,14H2,(H,27,30) |
| InChIKey | YWWJKAZYDVTMEH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|