C29H16F6O8S2 — CID 87813181
9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene-2,7-disulfonic acid (PubChem CID 87813181) has the molecular formula C29H16F6O8S2 and a molecular weight of 670.56 g/mol. Its IUPAC name is 9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene-2,7-disulfonic acid.
| Compound Name | 9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 87813181 |
| Molecular Formula | C29H16F6O8S2 |
| Molecular Weight | 670.56 g/mol |
| Exact Mass | 670.02 |
| IUPAC Name | 9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)C(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1cc(S(=O)(=O)O)ccc1-2 |
| InChI | InChI=1S/C29H16F6O8S2/c30-25(31)27(34)42-17-5-1-15(2-6-17)29(16-3-7-18(8-4-16)43-28(35)26(32)33)23-13-19(44(36,37)38)9-11-21(23)22-12-10-20(14-24(22)29)45(39,40)41/h1-14H,(H,36,37,38)(H,39,40,41) |
| InChIKey | OJJIHHDYNJWIBL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.56 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|