About 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane
2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87813388) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 87813388 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC=C(C)C |
| InChI | InChI=1S/C6H10O3.C5H10/c1(5-3-8-5)7-2-6-4-9-6;1-4-5(2)3/h5-6H,1-4H2;4H,1-3H3 |
| InChIKey | FIBHKJAXLYRNGD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 87813388) is 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CC=C(C)C.
What is the InChIKey of 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is FIBHKJAXLYRNGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C5H10/c1(5-3-8-5)7-2-6-4-9-6;1-4-5(2)3/h5-6H,1-4H2;4H,1-3H3.
What are the key properties of 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 200.28 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 87813388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).