C8H12F2O5 — CID 87813435
3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoropropaneperoxoic acid (PubChem CID 87813435) has the molecular formula C8H12F2O5 and a molecular weight of 226.17 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoropropaneperoxoic acid.
| Compound Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoropropaneperoxoic acid |
|---|---|
| PubChem CID | 87813435 |
| Molecular Formula | C8H12F2O5 |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoropropaneperoxoic acid |
| SMILES | CC1(C)OCC(CC(F)(F)C(=O)OO)O1 |
| InChI | InChI=1S/C8H12F2O5/c1-7(2)13-4-5(14-7)3-8(9,10)6(11)15-12/h5,12H,3-4H2,1-2H3 |
| InChIKey | LXQMOULRVSRGLO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|