C19H16Cl2F6N2O2 — CID 87813833
4-[[2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 87813833) has the molecular formula C19H16Cl2F6N2O2 and a molecular weight of 489.24 g/mol. Its IUPAC name is 4-[[2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 87813833 |
| Molecular Formula | C19H16Cl2F6N2O2 |
| Molecular Weight | 489.24 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 4-[[2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1cc(NCC(O)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C19H16Cl2F6N2O2/c1-10-4-14(2-3-15(10)16(30)29-9-18(22,23)24)28-8-17(31,19(25,26)27)11-5-12(20)7-13(21)6-11/h2-7,28,31H,8-9H2,1H3,(H,29,30) |
| InChIKey | GWUNMTWAVFJOGL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.24 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |