About but-3-enal;1H-indole
but-3-enal;1H-indole (PubChem CID 87814058) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is but-3-enal;1H-indole.
Molecular Properties
| Compound Name | but-3-enal;1H-indole |
| PubChem CID | 87814058 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | but-3-enal;1H-indole |
| SMILES | C=CCC=O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C4H6O/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4-5/h1-6,9H;2,4H,1,3H2 |
| InChIKey | PAFKLZWWMJEEFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enal;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enal;1H-indole?
The IUPAC name of but-3-enal;1H-indole (CID 87814058) is but-3-enal;1H-indole.
What is the SMILES notation for but-3-enal;1H-indole?
The canonical SMILES for but-3-enal;1H-indole is C=CCC=O.c1ccc2[nH]ccc2c1.
What is the InChIKey of but-3-enal;1H-indole?
The InChIKey is PAFKLZWWMJEEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C4H6O/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4-5/h1-6,9H;2,4H,1,3H2.
What are the key properties of but-3-enal;1H-indole?
but-3-enal;1H-indole has a molecular weight of 187.24 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enal;1H-indole is sourced from PubChem (CID 87814058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).