C12H26O3 — CID 87814111
4-(2-hydroxypropan-2-yl)-2,6-dimethylheptane-2,6-diol (PubChem CID 87814111) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yl)-2,6-dimethylheptane-2,6-diol.
| Compound Name | 4-(2-hydroxypropan-2-yl)-2,6-dimethylheptane-2,6-diol |
|---|---|
| PubChem CID | 87814111 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 4-(2-hydroxypropan-2-yl)-2,6-dimethylheptane-2,6-diol |
| SMILES | CC(C)(O)CC(CC(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C12H26O3/c1-10(2,13)7-9(12(5,6)15)8-11(3,4)14/h9,13-15H,7-8H2,1-6H3 |
| InChIKey | XKVKFSHTFZVKEB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |